Chất H2 có các tên gọi phổ biến là gì ?

Thông tin chi tiết tên gọi của của H2

Tên Tiếng Việt

Tên gọi thông thường của H2Hidro

Xin lưu ý đây là tên gọi được dùng trong chương trình hóa phổ thông. Mỗi năm học nếu có thay đổi sách giáo khoa và làm thay đổi quy tắc gọi tên. Nếu bạn thấy tên gọi này không chính xác xin hãy gửi email cho chúng tôi tại [email protected]

Thông tin phân loại

Xin hãy xem thêm các phân loại để hiểu rõ hơn vì sao hất hóa học H2 có tên gọi là Hidro. Chất có các phân loại là Đơn chất, Nguyên Tố Chu Kỳ 1, Nhóm Nguyên Tố IA, Nhóm Nguyên Tố VIIA, Nguyên Tố Bảng Tuần Hoàn

Giới thiệu về chất H2

Một số người coi khí hydro là nhiên liệu sạch của tương lai - được tạo ra từ nước và trở lại nước khi nó bị oxy hóa. Pin nhiên liệu chạy bằng hydro ngày càng được coi là nguồn năng lượng 'không gây ô nhiễm' và hiện đang được sử dụng trong một số xe buýt và ô tô. Hydro còn có nhiều công dụng khác. Trong công nghiệp hóa chất, nó được sử dụng để sản xuất amoniac cho phân bón nông nghiệp (quy trình Haber) và xyclohexan và metanol, là những chất trung gian trong sản xuất nhựa và dược phẩm. Nó cũng được sử dụng để loại bỏ lưu huỳnh khỏi nhiên liệu trong quá trình lọc dầu. Một lượng lớn hydro được sử dụng để hydro hóa dầu để tạo thành chất béo, ví dụ như để sản xuất bơ thực vật. Trong công nghiệp thủy tinh, hydro được sử dụng làm khí bảo vệ để chế tạo các tấm thủy tinh phẳng. Trong ngành công nghiệp điện tử, nó được sử dụng làm khí xả trong quá trình sản xuất chip silicon. Mật độ hydro thấp khiến nó trở thành sự lựa chọn tự nhiên cho một trong những ứng dụng thực tế đầu tiên của nó - làm đầy khí cầu và khí cầu. Tuy nhiên, nó phản ứng mạnh mẽ với oxy (để tạo thành nước) và tương lai của nó trong việc lấp đầy khí cầu đã kết thúc khi khí cầu Hindenburg bốc cháy.

H2 là chất tham gia của các phương trình hóa học nào?

Phân loại theo các lớp học. Xin lưu ý là đôi khi phương trình sẽ được xuất hiện nhiều lần trong các sách giáo khoa

Phương trình hóa học Lớp 8

Chúng mình tìm thấy các phương trình sau trong các sách giáo khoa, bài tập hóa học của lớp 8 CuO + H2 -> Cu + H2O Chúng mình tìm thấy các phương trình sau trong các sách giáo khoa, bài tập hóa học của lớp 8 H2 + O2 -> H2O Chúng mình tìm thấy các phương trình sau trong các sách giáo khoa, bài tập hóa học của lớp 8 H2 + Fe3O4 -> Fe + H2O

Phương trình hóa học Lớp 9

Chúng mình tìm thấy các phương trình sau trong các sách giáo khoa, bài tập hóa học của lớp 9 Cl2 + H2 -> HCl Chúng mình tìm thấy các phương trình sau trong các sách giáo khoa, bài tập hóa học của lớp 9 H2 + O2 -> H2O

Phương trình hóa học Lớp 10

Chúng mình tìm thấy các phương trình sau trong các sách giáo khoa, bài tập hóa học của lớp 10 Br2 + H2 -> HBr Cl2 + H2 -> HCl CuO + H2 -> Cu + H2O H2 + N2 -> NH3 H2 + O2 -> H2O H2 + I2 -> HI H2 + S -> H2S F2 + H2 -> HF H2 + CH3CH2CHO -> CH3CH2CH2OH H2 + PbO2 -> H2O + Pb Fe2O3 + H2 -> FeO + H2O

Phương trình hóa học Lớp 11

Chúng mình tìm thấy các phương trình sau trong các sách giáo khoa, bài tập hóa học của lớp 11 CH3CHO + H2 -> C2H5OH C + H2 -> CH4 H2 + CH2=CHCH3 -> CH3-CH2-CH3 H2 + CH3CH2CH=O -> CH3CH2CH2OH H2 + C6H5CHCH2 -> C6H5CH2CH3 H2 + CH2=CH-COOH -> CH3CH2COOH H2 + CH2=CHCH2OH -> CH3CH2CH2OH H2 + RCHO -> RCH2OH H2 + C4H4 -> CH2=CHCH=CH2

Phương trình hóa học Lớp 12

Chúng mình tìm thấy các phương trình sau trong các sách giáo khoa, bài tập hóa học của lớp 12 H2 + CH3(CH2)7CH=CH(CH2)7CO2CH3 -> CH3(CH2)16CO2CH3 H2 + (C17H33COO)3C3H5 -> (C17H35COO)3C3H5 H2 + (C17H31COO)3C3H5 -> (C17H35COO)3C3H5 H2 + C12H22O11 -> H2O + CH3CH2COOH H2 + (CH3)2CHCH2CH=O -> (CH3)2CHCH2CH2OH

H2 là chất sản phẩm của các phương trình hóa học nào?

Phân loại theo các lớp học. Xin lưu ý là đôi khi phương trình sẽ được xuất hiện nhiều lần trong các sách giáo khoa

Phương trình hóa học Lớp 8

Chúng mình tìm thấy các phương trình sau trong các sách giáo khoa, bài tập hóa học của lớp 8 Al + HCl -> AlCl3 + H2 Fe + H2SO4 -> H2 + FeSO4 Fe + HCl -> FeCl2 + H2 H2O -> H2 + O2 H2SO4 + Zn -> H2 + ZnSO4 HCl + Zn -> H2 + ZnCl2 H2O + Na -> H2 + NaOH Ag + H2O -> AgOH + H2 H2O + C3H8 -> CO + H2 H2O + KH -> H2 + KOH

Phương trình hóa học Lớp 9

Chúng mình tìm thấy các phương trình sau trong các sách giáo khoa, bài tập hóa học của lớp 9 Al + H2SO4 -> Al2(SO4)3 + H2 Al + HCl -> AlCl3 + H2 Fe + H2SO4 -> H2 + FeSO4 Fe + HCl -> FeCl2 + H2 H2O + NaCl -> Cl2 + H2 + NaOH H2SO4 + Zn -> H2 + ZnSO4 HCl + Mg -> H2 + MgCl2 HCl + Zn -> H2 + ZnCl2 H2SO4 + Mg -> H2 + MgSO4 C2H5OH + Na -> H2 + C2H5ONa H2O + Na -> H2 + NaOH Ca + H2SO4 -> H2 + CaSO4 Ag + H2O -> AgOH + H2 H2O + C3H8 -> CO + H2 H2O + Na -> H2 + NaOH C6H12 -> C6H6 + H2 Ca + H3PO4 -> Ca3(PO4)2 + H2 H2O + KH -> H2 + KOH Mg + KHSO4 -> H2 + K2SO4 + MgSO4

Phương trình hóa học Lớp 10

Chúng mình tìm thấy các phương trình sau trong các sách giáo khoa, bài tập hóa học của lớp 10 C + H2O -> CO + H2 Ca + H2O -> Ca(OH)2 + H2 Fe + HCl -> FeCl2 + H2 H2O + NaCl -> Cl2 + H2 + NaOH HCl + Mg -> H2 + MgCl2 HCl + Zn -> H2 + ZnCl2 HI -> H2 + I2 CO + H2O -> H2 + CO2 CH4 + H2O -> CO + H2 CH4 + O2 -> CO + H2 H2O + NaH -> H2 + NaOH HBr -> Br2 + H2 H2O + Na -> H2 + NaOH Ca + H2SO4 -> H2 + CaSO4 Ag + H2O -> AgOH + H2 H2O + C3H8 -> CO + H2 Al + H2SO4 -> Al2(SO4)3 + H2 H2O + KH -> H2 + KOH Mg + KHSO4 -> H2 + K2SO4 + MgSO4

Phương trình hóa học Lớp 11

Chúng mình tìm thấy các phương trình sau trong các sách giáo khoa, bài tập hóa học của lớp 11 C + H2O -> CO + H2 H2O + NaOH + Si -> H2 + Na2SiO3 C2H6 -> C2H4 + H2 C4H10 -> CH3CH=CHCH3 + H2 CH4 -> C + H2 Ca + H2SO4 -> H2 + CaSO4 H2O + NaOH + Zn -> H2 + NaZnO2 Ca + H2O + FeCl3 -> H2 + CaCl2 + Fe(OH)3 Na + C2H5COOH -> H2 + C2H5COONa Na + CH3-CO-CH2OH -> H2 + CH3-CO-CH2ONa H2O + Ba + CuSO4 -> Cu(OH)2 + H2 + BaSO4 C6H6 + HCl -> H2 + C6H4Cl2 Ag + H2O -> AgOH + H2 H2O + C3H8 -> CO + H2 Na + CH3CH(OH)COOH -> H2 + CH3CH(ONa)COONa C6H5OH + Na -> C6H5ONa + H2 C2H2 + Na -> H2 + Na2C2 C6H12 -> C6H6 + H2 Ca + H3PO4 -> Ca3(PO4)2 + H2 H2O + KH -> H2 + KOH H2O + K + CuSO4 -> Cu(OH)2 + H2 + K2SO4

Phương trình hóa học Lớp 12

Chúng mình tìm thấy các phương trình sau trong các sách giáo khoa, bài tập hóa học của lớp 12 Ca + HCl -> H2 + CaCl2 Al + H2O + NaOH -> H2 + Na[AlOH]4 Fe + H2O -> H2 + Fe3O4 Cr + HCl -> H2 + CrCl2 Ca + H2SO4 -> H2 + CaSO4 FeCl2 + H2O + Na -> H2 + Na2SO4 + Fe(OH)2 AlCl3 + H2O + Na -> H2 + NaCl + NaAlO2 H2O + NaOH + Zn -> H2 + NaZnO2 Ca + H2O + FeCl3 -> H2 + CaCl2 + Fe(OH)3 Na + C2H5COOH -> H2 + C2H5COONa Na + CH3-CO-CH2OH -> H2 + CH3-CO-CH2ONa H2O + Ba + CuSO4 -> Cu(OH)2 + H2 + BaSO4 Ag + H2O -> AgOH + H2 H2O + C3H8 -> CO + H2 H2O + Na -> H2 + NaOH H2O + KH -> H2 + KOH C + NaOH -> H2 + Na + Na2CO3 H2O + K + CuSO4 -> Cu(OH)2 + H2 + K2SO4 Cr + H2SO4 -> H2 + CrSO4 Al + H2O + KOH -> H2 + KAlO2

Các chất hóa học gần giống nhất với so với chất bạn tìm kiểm

Chất H2 - Viết tự nhiên là: H2

Đơn chất Nguyên Tố Chu Kỳ 1 Nhóm Nguyên Tố IA Nhóm Nguyên Tố VIIA Nguyên Tố Bảng Tuần Hoàn

Tên gọi Tiếng Việt: hidro

Tên gọi Tiếng Anh: hydrogen

Tìm hiểu thêm về tên gọi của chất H2 và các phương trình liên quan

Chất H - Viết tự nhiên là: H


Tên gọi Tiếng Việt: Hiđro

Tên gọi Tiếng Anh: Hydrogen

Tìm hiểu thêm về tên gọi của chất H và các phương trình liên quan

Các đối tác

Loading…